C26H20ClNO2 — CID 67124589
(E)-3-(4-chlorophenyl)-2-[4-(2-quinolin-2-ylethyl)phenyl]prop-2-enoic acid (PubChem CID 67124589) has the molecular formula C26H20ClNO2 and a molecular weight of 413.90 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-[4-(2-quinolin-2-ylethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-(4-chlorophenyl)-2-[4-(2-quinolin-2-ylethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67124589 |
| Molecular Formula | C26H20ClNO2 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-[4-(2-quinolin-2-ylethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1ccc(Cl)cc1)c1ccc(CCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H20ClNO2/c27-22-13-7-19(8-14-22)17-24(26(29)30)20-10-5-18(6-11-20)9-15-23-16-12-21-3-1-2-4-25(21)28-23/h1-8,10-14,16-17H,9,15H2,(H,29,30)/b24-17+ |
| InChIKey | KZLLWAAOVFQSEX-JJIBRWJFSA-N |
| XLogP | 6.30 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|