C29H27ClN2O3 — CID 67124755
3-(4-chlorophenyl)-N-(2-hydroxybutan-2-yl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 67124755) has the molecular formula C29H27ClN2O3 and a molecular weight of 487.00 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2-hydroxybutan-2-yl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2-hydroxybutan-2-yl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67124755 |
| Molecular Formula | C29H27ClN2O3 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2-hydroxybutan-2-yl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | CCC(C)(O)NC(=O)C(=Cc1ccc(Cl)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H27ClN2O3/c1-3-29(2,34)32-28(33)26(18-20-8-13-23(30)14-9-20)21-11-16-25(17-12-21)35-19-24-15-10-22-6-4-5-7-27(22)31-24/h4-18,34H,3,19H2,1-2H3,(H,32,33) |
| InChIKey | VMWONMDDVLLODK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|