C29H25N3O3 — CID 67124597
N-(2-cyanoethyl)-3-(4-methoxyphenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 67124597) has the molecular formula C29H25N3O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(4-methoxyphenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | N-(2-cyanoethyl)-3-(4-methoxyphenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67124597 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-(2-cyanoethyl)-3-(4-methoxyphenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | COc1ccc(C=C(C(=O)NCCC#N)c2ccc(OCc3ccc4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C29H25N3O3/c1-34-25-13-7-21(8-14-25)19-27(29(33)31-18-4-17-30)22-10-15-26(16-11-22)35-20-24-12-9-23-5-2-3-6-28(23)32-24/h2-3,5-16,19H,4,18,20H2,1H3,(H,31,33) |
| InChIKey | JYUVRGGYGWMTJC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|