C26H21N3O2S — CID 54590948
(E)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 54590948) has the molecular formula C26H21N3O2S and a molecular weight of 439.54 g/mol. Its IUPAC name is (E)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 54590948 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (E)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | N#CCCNC(=O)/C(=C/c1cccs1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H21N3O2S/c27-14-4-15-28-26(30)24(17-23-6-3-16-32-23)19-9-12-22(13-10-19)31-18-21-11-8-20-5-1-2-7-25(20)29-21/h1-3,5-13,16-17H,4,15,18H2,(H,28,30)/b24-17+ |
| InChIKey | HXCYGGZBETYMFI-JJIBRWJFSA-N |
| XLogP | 5.45 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|