C29H28ClN3O2 — CID 54591118
(E)-3-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 54591118) has the molecular formula C29H28ClN3O2 and a molecular weight of 486.02 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 54591118 |
| Molecular Formula | C29H28ClN3O2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | CN(C)CCNC(=O)/C(=C/c1ccc(Cl)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H28ClN3O2/c1-33(2)18-17-31-29(34)27(19-21-7-12-24(30)13-8-21)22-10-15-26(16-11-22)35-20-25-14-9-23-5-3-4-6-28(23)32-25/h3-16,19H,17-18,20H2,1-2H3,(H,31,34)/b27-19+ |
| InChIKey | JOZONIBBUMWPIO-ZXVVBBHZSA-N |
| XLogP | 5.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|