C27H26ClN3O2 — CID 123266598
N-(2-aminoethyl)-2-[4-[[5,6-bis(ethenyl)-2-pyridinyl]methoxy]phenyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 123266598) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[4-[[5,6-bis(ethenyl)-2-pyridinyl]methoxy]phenyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | N-(2-aminoethyl)-2-[4-[[5,6-bis(ethenyl)-2-pyridinyl]methoxy]phenyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 123266598 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-(2-aminoethyl)-2-[4-[[5,6-bis(ethenyl)-2-pyridinyl]methoxy]phenyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | C=Cc1ccc(COc2ccc(C(=Cc3ccc(Cl)cc3)C(=O)NCCN)cc2)nc1C=C |
| InChI | InChI=1S/C27H26ClN3O2/c1-3-20-7-12-23(31-26(20)4-2)18-33-24-13-8-21(9-14-24)25(27(32)30-16-15-29)17-19-5-10-22(28)11-6-19/h3-14,17H,1-2,15-16,18,29H2,(H,30,32) |
| InChIKey | MRKQVBRYIMCVMP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|