C28H22ClN3O2 — CID 67124500
3-(3-chlorophenyl)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 67124500) has the molecular formula C28H22ClN3O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | 3-(3-chlorophenyl)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67124500 |
| Molecular Formula | C28H22ClN3O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | N#CCCNC(=O)C(=Cc1cccc(Cl)c1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H22ClN3O2/c29-23-7-3-5-20(17-23)18-26(28(33)31-16-4-15-30)21-10-13-25(14-11-21)34-19-24-12-9-22-6-1-2-8-27(22)32-24/h1-3,5-14,17-18H,4,16,19H2,(H,31,33) |
| InChIKey | FOEBWOLESWXVNV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|