C28H24ClN3O — CID 70169800
3-[[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]amino]propanenitrile (PubChem CID 70169800) has the molecular formula C28H24ClN3O and a molecular weight of 453.97 g/mol. Its IUPAC name is 3-[[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]amino]propanenitrile.
| Compound Name | 3-[[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]amino]propanenitrile |
|---|---|
| PubChem CID | 70169800 |
| Molecular Formula | C28H24ClN3O |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]amino]propanenitrile |
| SMILES | N#CCCNC/C(=C/c1ccc(Cl)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H24ClN3O/c29-25-11-6-21(7-12-25)18-24(19-31-17-3-16-30)22-9-14-27(15-10-22)33-20-26-13-8-23-4-1-2-5-28(23)32-26/h1-2,4-15,18,31H,3,17,19-20H2/b24-18- |
| InChIKey | APNPTLYHPFJTAH-MOHJPFBDSA-N |
| XLogP | 6.51 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|