C29H27ClN2OS — CID 70168452
4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]thiomorpholine (PubChem CID 70168452) has the molecular formula C29H27ClN2OS and a molecular weight of 487.07 g/mol. Its IUPAC name is 4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]thiomorpholine.
| Compound Name | 4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]thiomorpholine |
|---|---|
| PubChem CID | 70168452 |
| Molecular Formula | C29H27ClN2OS |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]thiomorpholine |
| SMILES | Clc1ccc(/C=C(/CN2CCSCC2)c2ccc(OCc3ccc4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C29H27ClN2OS/c30-26-10-5-22(6-11-26)19-25(20-32-15-17-34-18-16-32)23-8-13-28(14-9-23)33-21-27-12-7-24-3-1-2-4-29(24)31-27/h1-14,19H,15-18,20-21H2/b25-19- |
| InChIKey | UBAKWUYUPCMPMY-PLRJNAJWSA-N |
| XLogP | 7.06 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|