C29H25ClN2O2 — CID 70169804
(E)-3-(4-chlorophenyl)-1-pyrrolidin-1-yl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 70169804) has the molecular formula C29H25ClN2O2 and a molecular weight of 468.98 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-pyrrolidin-1-yl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-pyrrolidin-1-yl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70169804 |
| Molecular Formula | C29H25ClN2O2 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-pyrrolidin-1-yl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(Cl)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1)N1CCCC1 |
| InChI | InChI=1S/C29H25ClN2O2/c30-24-12-7-21(8-13-24)19-27(29(33)32-17-3-4-18-32)22-10-15-26(16-11-22)34-20-25-14-9-23-5-1-2-6-28(23)31-25/h1-2,5-16,19H,3-4,17-18,20H2/b27-19+ |
| InChIKey | KRFDHNQWMPZZTN-ZXVVBBHZSA-N |
| XLogP | 6.63 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|