C27H24ClN3O3 — CID 123738402
N-(2-amino-2-hydroxyethyl)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 123738402) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyethyl)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | N-(2-amino-2-hydroxyethyl)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123738402 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-(2-amino-2-hydroxyethyl)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | NC(O)CNC(=O)C(=Cc1ccc(Cl)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H24ClN3O3/c28-21-10-5-18(6-11-21)15-24(27(33)30-16-26(29)32)19-8-13-23(14-9-19)34-17-22-12-7-20-3-1-2-4-25(20)31-22/h1-15,26,32H,16-17,29H2,(H,30,33) |
| InChIKey | GCCMFZURXOYYBX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|