C28H24N2O4 — CID 70168941
2-[[(E)-3-phenyl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]amino]propanoic acid (PubChem CID 70168941) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[[(E)-3-phenyl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(E)-3-phenyl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70168941 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[[(E)-3-phenyl-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)/C(=C/c1ccccc1)c1ccc(OCc2ccc3ccccc3n2)cc1)C(=O)O |
| InChI | InChI=1S/C28H24N2O4/c1-19(28(32)33)29-27(31)25(17-20-7-3-2-4-8-20)21-12-15-24(16-13-21)34-18-23-14-11-22-9-5-6-10-26(22)30-23/h2-17,19H,18H2,1H3,(H,29,31)(H,32,33)/b25-17+ |
| InChIKey | INTKJWUYOCPHBZ-KOEQRZSOSA-N |
| XLogP | 4.94 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|