C29H22F3N3O3 — CID 67124693
N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 67124693) has the molecular formula C29H22F3N3O3 and a molecular weight of 517.51 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67124693 |
| Molecular Formula | C29H22F3N3O3 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | N-(2-cyanoethyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | N#CCCNC(=O)C(=Cc1ccc(OC(F)(F)F)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H22F3N3O3/c30-29(31,32)38-25-12-6-20(7-13-25)18-26(28(36)34-17-3-16-33)21-9-14-24(15-10-21)37-19-23-11-8-22-4-1-2-5-27(22)35-23/h1-2,4-15,18H,3,17,19H2,(H,34,36) |
| InChIKey | BEGQFOKRKYNLRP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|