C26H18ClN3O3 — CID 67124721
5-[2-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]ethenyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 67124721) has the molecular formula C26H18ClN3O3 and a molecular weight of 455.90 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]ethenyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[2-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]ethenyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 67124721 |
| Molecular Formula | C26H18ClN3O3 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]ethenyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | O=c1[nH]nc(C(=Cc2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4n3)cc2)o1 |
| InChI | InChI=1S/C26H18ClN3O3/c27-20-10-5-17(6-11-20)15-23(25-29-30-26(31)33-25)18-8-13-22(14-9-18)32-16-21-12-7-19-3-1-2-4-24(19)28-21/h1-15H,16H2,(H,30,31) |
| InChIKey | ZPUJDWQSYUORMT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|