C29H26ClN3O2 — CID 54591277
4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]piperazin-2-one (PubChem CID 54591277) has the molecular formula C29H26ClN3O2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]piperazin-2-one.
| Compound Name | 4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]piperazin-2-one |
|---|---|
| PubChem CID | 54591277 |
| Molecular Formula | C29H26ClN3O2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 4-[(E)-3-(4-chlorophenyl)-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enyl]piperazin-2-one |
| SMILES | O=C1CN(C/C(=C/c2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4n3)cc2)CCN1 |
| InChI | InChI=1S/C29H26ClN3O2/c30-25-10-5-21(6-11-25)17-24(18-33-16-15-31-29(34)19-33)22-8-13-27(14-9-22)35-20-26-12-7-23-3-1-2-4-28(23)32-26/h1-14,17H,15-16,18-20H2,(H,31,34)/b24-17- |
| InChIKey | WCZARTBPHJVGBG-ULJHMMPZSA-N |
| XLogP | 5.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|