C29H25ClN2O3 — CID 54591732
(E)-3-(4-chlorophenyl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 54591732) has the molecular formula C29H25ClN2O3 and a molecular weight of 484.98 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54591732 |
| Molecular Formula | C29H25ClN2O3 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(Cl)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C29H25ClN2O3/c30-23-10-5-20(6-11-23)17-27(29(34)32-16-15-25(33)18-32)21-8-13-26(14-9-21)35-19-24-12-7-22-3-1-2-4-28(22)31-24/h1-14,17,25,33H,15-16,18-19H2/b27-17+/t25-/m1/s1 |
| InChIKey | PICQKFQQUKZXDZ-JOWQQVNMSA-N |
| XLogP | 5.60 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|