C7H10N2OS — CID 67154481
2-(azetidin-3-yloxymethyl)-1,3-thiazole (PubChem CID 67154481) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-(azetidin-3-yloxymethyl)-1,3-thiazole.
| Compound Name | 2-(azetidin-3-yloxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 67154481 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(azetidin-3-yloxymethyl)-1,3-thiazole |
| SMILES | c1csc(COC2CNC2)n1 |
| InChI | InChI=1S/C7H10N2OS/c1-2-11-7(9-1)5-10-6-3-8-4-6/h1-2,6,8H,3-5H2 |
| InChIKey | BUVCQZXCMKASNX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |