C42H47NO6 — CID 67164067
2-O-benzyl 1-O-tert-butyl (2S,3aR,5R,6R,7S,7aS)-6,7-dibenzyl-5-(1-hydroxy-2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,2-dicarboxylate (PubChem CID 67164067) has the molecular formula C42H47NO6 and a molecular weight of 661.84 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,3aR,5R,6R,7S,7aS)-6,7-dibenzyl-5-(1-hydroxy-2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,3aR,5R,6R,7S,7aS)-6,7-dibenzyl-5-(1-hydroxy-2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67164067 |
| Molecular Formula | C42H47NO6 |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 661.34 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,3aR,5R,6R,7S,7aS)-6,7-dibenzyl-5-(1-hydroxy-2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2[C@@H](Cc3ccccc3)[C@@H](Cc3ccccc3)[C@H](C(O)Cc3ccccc3)O[C@@H]2C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C42H47NO6/c1-42(2,3)49-41(46)43-35(40(45)47-28-32-22-14-7-15-23-32)27-37-38(43)33(24-29-16-8-4-9-17-29)34(25-30-18-10-5-11-19-30)39(48-37)36(44)26-31-20-12-6-13-21-31/h4-23,33-39,44H,24-28H2,1-3H3/t33-,34+,35-,36?,37+,38-,39+/m0/s1 |
| InChIKey | FMLICYAVDOBNTQ-CEADLKIJSA-N |
| XLogP | 7.20 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |