C30H30N2O4S — CID 67173431
tert-butyl 5-(benzenesulfonyl)-9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate (PubChem CID 67173431) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is tert-butyl 5-(benzenesulfonyl)-9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate.
| Compound Name | tert-butyl 5-(benzenesulfonyl)-9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67173431 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | tert-butyl 5-(benzenesulfonyl)-9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(S(=O)(=O)c2ccccc2)ccc2c1c1c(n2-c2ccccc2)CC2CCC1N2 |
| InChI | InChI=1S/C30H30N2O4S/c1-30(2,3)36-29(33)28-25(37(34,35)21-12-8-5-9-13-21)17-16-23-27(28)26-22-15-14-19(31-22)18-24(26)32(23)20-10-6-4-7-11-20/h4-13,16-17,19,22,31H,14-15,18H2,1-3H3 |
| InChIKey | QCIMUWMHHICVOA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |