C28H31N3O4S — CID 67173590
tert-butyl 5-indol-1-ylsulfonyl-7,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate (PubChem CID 67173590) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is tert-butyl 5-indol-1-ylsulfonyl-7,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate.
| Compound Name | tert-butyl 5-indol-1-ylsulfonyl-7,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67173590 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | tert-butyl 5-indol-1-ylsulfonyl-7,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
| SMILES | Cc1cc(S(=O)(=O)n2ccc3ccccc32)c(C(=O)OC(C)(C)C)c2c3c(n(C)c12)CC1CCC3N1 |
| InChI | InChI=1S/C28H31N3O4S/c1-16-14-22(36(33,34)31-13-12-17-8-6-7-9-20(17)31)24(27(32)35-28(2,3)4)25-23-19-11-10-18(29-19)15-21(23)30(5)26(16)25/h6-9,12-14,18-19,29H,10-11,15H2,1-5H3 |
| InChIKey | LOBFWFOBPQSVLW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |