C26H30N2O5S — CID 67085572
tert-butyl 5-(4-methoxyphenyl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate (PubChem CID 67085572) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is tert-butyl 5-(4-methoxyphenyl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate.
| Compound Name | tert-butyl 5-(4-methoxyphenyl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67085572 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | tert-butyl 5-(4-methoxyphenyl)sulfonyl-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)c2ccc3c(c2C(=O)OC(C)(C)C)c2c(n3C)CC3CCC2N3)cc1 |
| InChI | InChI=1S/C26H30N2O5S/c1-26(2,3)33-25(29)24-21(34(30,31)17-9-7-16(32-5)8-10-17)13-12-19-23(24)22-18-11-6-15(27-18)14-20(22)28(19)4/h7-10,12-13,15,18,27H,6,11,14H2,1-5H3 |
| InChIKey | XCGBOPHPLUNNRL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |