C25H27N3O6S — CID 67085522
tert-butyl 9-methyl-5-(3-nitrophenyl)sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate (PubChem CID 67085522) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is tert-butyl 9-methyl-5-(3-nitrophenyl)sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate.
| Compound Name | tert-butyl 9-methyl-5-(3-nitrophenyl)sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67085522 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | tert-butyl 9-methyl-5-(3-nitrophenyl)sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-4-carboxylate |
| SMILES | Cn1c2c(c3c(C(=O)OC(C)(C)C)c(S(=O)(=O)c4cccc([N+](=O)[O-])c4)ccc31)C1CCC(C2)N1 |
| InChI | InChI=1S/C25H27N3O6S/c1-25(2,3)34-24(29)23-20(35(32,33)16-7-5-6-15(13-16)28(30)31)11-10-18-22(23)21-17-9-8-14(26-17)12-19(21)27(18)4/h5-7,10-11,13-14,17,26H,8-9,12H2,1-4H3 |
| InChIKey | KBENAPRKAKDTKS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|