C29H34N4O3S — CID 67189214
2-[7-methoxy-6-[3-(piperidin-1-ylmethyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 67189214) has the molecular formula C29H34N4O3S and a molecular weight of 518.68 g/mol. Its IUPAC name is 2-[7-methoxy-6-[3-(piperidin-1-ylmethyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 2-[7-methoxy-6-[3-(piperidin-1-ylmethyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 67189214 |
| Molecular Formula | C29H34N4O3S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 2-[7-methoxy-6-[3-(piperidin-1-ylmethyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | COc1cc2c(cc1-c1cccc(CN3CCCCC3)c1)N(c1nc3c(s1)C(=O)NC(C)(C)C3)CCO2 |
| InChI | InChI=1S/C29H34N4O3S/c1-29(2)17-22-26(27(34)31-29)37-28(30-22)33-12-13-36-25-16-24(35-3)21(15-23(25)33)20-9-7-8-19(14-20)18-32-10-5-4-6-11-32/h7-9,14-16H,4-6,10-13,17-18H2,1-3H3,(H,31,34) |
| InChIKey | OLXWEEOCGPVWJU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |