C16H16N6O3 — CID 6722936
(2S)-3-hydroxy-2-[3-(1H-indol-3-yl)prop-2-enoylamino]-N-(1,2,4-triazol-4-yl)propanamide (PubChem CID 6722936) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[3-(1H-indol-3-yl)prop-2-enoylamino]-N-(1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2S)-3-hydroxy-2-[3-(1H-indol-3-yl)prop-2-enoylamino]-N-(1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 6722936 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2S)-3-hydroxy-2-[3-(1H-indol-3-yl)prop-2-enoylamino]-N-(1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(C=Cc1c[nH]c2ccccc12)N[C@@H](CO)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C16H16N6O3/c23-8-14(16(25)21-22-9-18-19-10-22)20-15(24)6-5-11-7-17-13-4-2-1-3-12(11)13/h1-7,9-10,14,17,23H,8H2,(H,20,24)(H,21,25)/t14-/m0/s1 |
| InChIKey | QXEFRHWUOKOLPQ-AWEZNQCLSA-N |
| XLogP | 0.02 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|