C29H24N6O4 — CID 67238420
N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutyl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 67238420) has the molecular formula C29H24N6O4 and a molecular weight of 520.55 g/mol. Its IUPAC name is N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutyl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutyl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67238420 |
| Molecular Formula | C29H24N6O4 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutyl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(CC(NC(=O)c1cccnc1-n1ccc(-c2ccccc2)n1)c1ccccc1)C(=O)NCc1ncco1 |
| InChI | InChI=1S/C29H24N6O4/c36-25(29(38)32-19-26-30-15-17-39-26)18-24(21-10-5-2-6-11-21)33-28(37)22-12-7-14-31-27(22)35-16-13-23(34-35)20-8-3-1-4-9-20/h1-17,24H,18-19H2,(H,32,38)(H,33,37) |
| InChIKey | FCQPBDRUNQQHCB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|