C18H17IN2S — CID 67240414
(E)-1-(1,3-benzothiazol-2-yl)-1-iodo-N,N-dimethyl-3-phenylprop-2-en-1-amine (PubChem CID 67240414) has the molecular formula C18H17IN2S and a molecular weight of 420.32 g/mol. Its IUPAC name is (E)-1-(1,3-benzothiazol-2-yl)-1-iodo-N,N-dimethyl-3-phenylprop-2-en-1-amine.
| Compound Name | (E)-1-(1,3-benzothiazol-2-yl)-1-iodo-N,N-dimethyl-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 67240414 |
| Molecular Formula | C18H17IN2S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (E)-1-(1,3-benzothiazol-2-yl)-1-iodo-N,N-dimethyl-3-phenylprop-2-en-1-amine |
| SMILES | CN(C)C(I)(/C=C/c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17IN2S/c1-21(2)18(19,13-12-14-8-4-3-5-9-14)17-20-15-10-6-7-11-16(15)22-17/h3-13H,1-2H3/b13-12+ |
| InChIKey | TVDRYOLSWVEXPW-OUKQBFOZSA-N |
| XLogP | 5.16 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|