C11H18N2O9 — CID 67304843
(2S)-2-(carboxyamino)pentanedioic acid;(2S)-3-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 67304843) has the molecular formula C11H18N2O9 and a molecular weight of 322.27 g/mol. Its IUPAC name is (2S)-2-(carboxyamino)pentanedioic acid;(2S)-3-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-2-(carboxyamino)pentanedioic acid;(2S)-3-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67304843 |
| Molecular Formula | C11H18N2O9 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (2S)-2-(carboxyamino)pentanedioic acid;(2S)-3-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)O)C(=O)O.O=C(O)[C@H]1NCCC1O |
| InChI | InChI=1S/C6H9NO6.C5H9NO3/c8-4(9)2-1-3(5(10)11)7-6(12)13;7-3-1-2-6-4(3)5(8)9/h3,7H,1-2H2,(H,8,9)(H,10,11)(H,12,13);3-4,6-7H,1-2H2,(H,8,9)/t3-;3?,4-/m00/s1 |
| InChIKey | JPNXUQQUUFFDHJ-DOFOJEBQSA-N |
| XLogP | -1.63 |
| TPSA | 193.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |