C17H18Cl2N2O2 — CID 67306040
1-[(2,4-dichlorophenyl)methyl]-4-hex-4-enoxypyrimidin-2-one (PubChem CID 67306040) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-4-hex-4-enoxypyrimidin-2-one.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-4-hex-4-enoxypyrimidin-2-one |
|---|---|
| PubChem CID | 67306040 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-4-hex-4-enoxypyrimidin-2-one |
| SMILES | CC=CCCCOc1ccn(Cc2ccc(Cl)cc2Cl)c(=O)n1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-2-3-4-5-10-23-16-8-9-21(17(22)20-16)12-13-6-7-14(18)11-15(13)19/h2-3,6-9,11H,4-5,10,12H2,1H3 |
| InChIKey | QHJOREMCAMZJDM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|