C27H28N6O4 — CID 6733604
2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl N-[2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 6733604) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl N-[2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 6733604 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | CCN(CCOC(=O)NCCc1c[nH]c2ccccc12)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H28N6O4/c1-2-32(17-18-37-27(34)28-16-15-20-19-29-26-6-4-3-5-25(20)26)23-11-7-21(8-12-23)30-31-22-9-13-24(14-10-22)33(35)36/h3-14,19,29H,2,15-18H2,1H3,(H,28,34)/b31-30+ |
| InChIKey | QLBQIRMNIFOJOY-NVQSTNCTSA-N |
| XLogP | 6.29 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|