C17H26ClN3O2 — CID 6734387
2-(3-chlorophenyl)ethyl N-[3-(4-methylpiperazin-1-yl)propyl]carbamate (PubChem CID 6734387) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 2-(3-chlorophenyl)ethyl N-[3-(4-methylpiperazin-1-yl)propyl]carbamate.
| Compound Name | 2-(3-chlorophenyl)ethyl N-[3-(4-methylpiperazin-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 6734387 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-(3-chlorophenyl)ethyl N-[3-(4-methylpiperazin-1-yl)propyl]carbamate |
| SMILES | CN1CCN(CCCNC(=O)OCCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-20-9-11-21(12-10-20)8-3-7-19-17(22)23-13-6-15-4-2-5-16(18)14-15/h2,4-5,14H,3,6-13H2,1H3,(H,19,22) |
| InChIKey | LELFICNHPRQTHQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|