C17H32O6 — CID 67349555
1,7-dioxacycloheptadecane-2,6-dione;ethane-1,2-diol (PubChem CID 67349555) has the molecular formula C17H32O6 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1,7-dioxacycloheptadecane-2,6-dione;ethane-1,2-diol.
| Compound Name | 1,7-dioxacycloheptadecane-2,6-dione;ethane-1,2-diol |
|---|---|
| PubChem CID | 67349555 |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1,7-dioxacycloheptadecane-2,6-dione;ethane-1,2-diol |
| SMILES | O=C1CCCC(=O)OCCCCCCCCCCO1.OCCO |
| InChI | InChI=1S/C15H26O4.C2H6O2/c16-14-10-9-11-15(17)19-13-8-6-4-2-1-3-5-7-12-18-14;3-1-2-4/h1-13H2;3-4H,1-2H2 |
| InChIKey | AXMVCWNPVUSDCP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |