C27H24N4O5 — CID 67417839
1-benzyl-3-[2-[cyano-(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]urea (PubChem CID 67417839) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is 1-benzyl-3-[2-[cyano-(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]urea.
| Compound Name | 1-benzyl-3-[2-[cyano-(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]urea |
|---|---|
| PubChem CID | 67417839 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-benzyl-3-[2-[cyano-(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]urea |
| SMILES | CCOc1cc(C(C#N)N2C(=O)c3cccc(NC(=O)NCc4ccccc4)c3C2=O)ccc1OC |
| InChI | InChI=1S/C27H24N4O5/c1-3-36-23-14-18(12-13-22(23)35-2)21(15-28)31-25(32)19-10-7-11-20(24(19)26(31)33)30-27(34)29-16-17-8-5-4-6-9-17/h4-14,21H,3,16H2,1-2H3,(H2,29,30,34) |
| InChIKey | KJZREXLQIPCUEP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|