C12H8ClNO2 — CID 67429297
2-(6-chloro-2,3-dihydroinden-1-ylidene)-2-cyanoacetic acid (PubChem CID 67429297) has the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. Its IUPAC name is 2-(6-chloro-2,3-dihydroinden-1-ylidene)-2-cyanoacetic acid.
| Compound Name | 2-(6-chloro-2,3-dihydroinden-1-ylidene)-2-cyanoacetic acid |
|---|---|
| PubChem CID | 67429297 |
| Molecular Formula | C12H8ClNO2 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 2-(6-chloro-2,3-dihydroinden-1-ylidene)-2-cyanoacetic acid |
| SMILES | N#CC(C(=O)O)=C1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H8ClNO2/c13-8-3-1-7-2-4-9(10(7)5-8)11(6-14)12(15)16/h1,3,5H,2,4H2,(H,15,16) |
| InChIKey | MQCZFUMBIWYXOW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|