C25H28O2 — CID 67461934
2-[(6E)-2,6-dimethylocta-2,6-dienyl]-2-phenyl-3H-chromen-4-one (PubChem CID 67461934) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-[(6E)-2,6-dimethylocta-2,6-dienyl]-2-phenyl-3H-chromen-4-one.
| Compound Name | 2-[(6E)-2,6-dimethylocta-2,6-dienyl]-2-phenyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 67461934 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-[(6E)-2,6-dimethylocta-2,6-dienyl]-2-phenyl-3H-chromen-4-one |
| SMILES | C/C=C(\C)CCC=C(C)CC1(c2ccccc2)CC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C25H28O2/c1-4-19(2)11-10-12-20(3)17-25(21-13-6-5-7-14-21)18-23(26)22-15-8-9-16-24(22)27-25/h4-9,12-16H,10-11,17-18H2,1-3H3/b19-4+,20-12? |
| InChIKey | VFGNIMMTGFRMEP-ALIHJKKXSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|