C4H5FN2S — CID 67482694
(4-fluoro-1,3-thiazol-2-yl)methanamine (PubChem CID 67482694) has the molecular formula C4H5FN2S and a molecular weight of 132.16 g/mol. Its IUPAC name is (4-fluoro-1,3-thiazol-2-yl)methanamine.
| Compound Name | (4-fluoro-1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 67482694 |
| Molecular Formula | C4H5FN2S |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | (4-fluoro-1,3-thiazol-2-yl)methanamine |
| SMILES | NCc1nc(F)cs1 |
| InChI | InChI=1S/C4H5FN2S/c5-3-2-8-4(1-6)7-3/h2H,1,6H2 |
| InChIKey | NBRXKFHQLMHKNU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |