C15H37N4O4P — CID 67521029
methyl phosphate;bis(1,2,3,4-tetramethylimidazolidin-1-ium) (PubChem CID 67521029) has the molecular formula C15H37N4O4P and a molecular weight of 368.46 g/mol. Its IUPAC name is methyl phosphate;bis(1,2,3,4-tetramethylimidazolidin-1-ium).
| Compound Name | methyl phosphate;bis(1,2,3,4-tetramethylimidazolidin-1-ium) |
|---|---|
| PubChem CID | 67521029 |
| Molecular Formula | C15H37N4O4P |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | methyl phosphate;bis(1,2,3,4-tetramethylimidazolidin-1-ium) |
| SMILES | CC1C[NH+](C)C(C)N1C.CC1C[NH+](C)C(C)N1C.COP(=O)([O-])[O-] |
| InChI | InChI=1S/2C7H16N2.CH5O4P/c2*1-6-5-8(3)7(2)9(6)4;1-5-6(2,3)4/h2*6-7H,5H2,1-4H3;1H3,(H2,2,3,4) |
| InChIKey | XAIMOAOBVQXIFY-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|