C19H29BN2O7S — CID 67523573
[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(methoxymethyl)sulfamoyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 67523573) has the molecular formula C19H29BN2O7S and a molecular weight of 440.33 g/mol. Its IUPAC name is [2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(methoxymethyl)sulfamoyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(methoxymethyl)sulfamoyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 67523573 |
| Molecular Formula | C19H29BN2O7S |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(methoxymethyl)sulfamoyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | COCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1B(O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C19H29BN2O7S/c1-13-14(2)21-28-17(13)22(12-27-7)30(25,26)16-11-9-8-10-15(16)20(24)29-19(5,6)18(3,4)23/h8-11,23-24H,12H2,1-7H3 |
| InChIKey | KLTZQAXIFMMKTM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|