C25H30O6 — CID 67541080
(1S,3S,4S,5R,6R)-3-methyl-4,5-bis(phenylmethoxy)-7-(prop-2-enoxymethyl)-2-oxabicyclo[4.1.0]heptane-1,6-diol (PubChem CID 67541080) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is (1S,3S,4S,5R,6R)-3-methyl-4,5-bis(phenylmethoxy)-7-(prop-2-enoxymethyl)-2-oxabicyclo[4.1.0]heptane-1,6-diol.
| Compound Name | (1S,3S,4S,5R,6R)-3-methyl-4,5-bis(phenylmethoxy)-7-(prop-2-enoxymethyl)-2-oxabicyclo[4.1.0]heptane-1,6-diol |
|---|---|
| PubChem CID | 67541080 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (1S,3S,4S,5R,6R)-3-methyl-4,5-bis(phenylmethoxy)-7-(prop-2-enoxymethyl)-2-oxabicyclo[4.1.0]heptane-1,6-diol |
| SMILES | C=CCOCC1[C@]2(O)O[C@@H](C)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@]12O |
| InChI | InChI=1S/C25H30O6/c1-3-14-28-17-21-24(26)23(30-16-20-12-8-5-9-13-20)22(18(2)31-25(21,24)27)29-15-19-10-6-4-7-11-19/h3-13,18,21-23,26-27H,1,14-17H2,2H3/t18-,21?,22-,23+,24+,25-/m0/s1 |
| InChIKey | RSZDUCGGMRMAFN-ZHPAMOFISA-N |
| XLogP | 2.83 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|