C22H21ClI2N2O4 — CID 67556830
5-[(3S)-4-[(1R)-1-(4-chlorophenyl)ethyl]-3,7-diiodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]pentanoic acid (PubChem CID 67556830) has the molecular formula C22H21ClI2N2O4 and a molecular weight of 666.68 g/mol. Its IUPAC name is 5-[(3S)-4-[(1R)-1-(4-chlorophenyl)ethyl]-3,7-diiodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]pentanoic acid.
| Compound Name | 5-[(3S)-4-[(1R)-1-(4-chlorophenyl)ethyl]-3,7-diiodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 67556830 |
| Molecular Formula | C22H21ClI2N2O4 |
| Molecular Weight | 666.68 g/mol |
| Exact Mass | 665.93 |
| IUPAC Name | 5-[(3S)-4-[(1R)-1-(4-chlorophenyl)ethyl]-3,7-diiodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]pentanoic acid |
| SMILES | C[C@H](c1ccc(Cl)cc1)N1C(=O)c2cc(I)ccc2N(CCCCC(=O)O)C(=O)[C@@H]1I |
| InChI | InChI=1S/C22H21ClI2N2O4/c1-13(14-5-7-15(23)8-6-14)27-20(25)22(31)26(11-3-2-4-19(28)29)18-10-9-16(24)12-17(18)21(27)30/h5-10,12-13,20H,2-4,11H2,1H3,(H,28,29)/t13-,20-/m1/s1 |
| InChIKey | FEFXQZLKNKMLKU-ZUOKHONESA-N |
| XLogP | 5.51 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|