C29H28Cl2IN5O3 — CID 69341026
(3S)-4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-oxo-2-piperazin-1-ylethyl)-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 69341026) has the molecular formula C29H28Cl2IN5O3 and a molecular weight of 692.39 g/mol. Its IUPAC name is (3S)-4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-oxo-2-piperazin-1-ylethyl)-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3S)-4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-oxo-2-piperazin-1-ylethyl)-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 69341026 |
| Molecular Formula | C29H28Cl2IN5O3 |
| Molecular Weight | 692.39 g/mol |
| Exact Mass | 691.06 |
| IUPAC Name | (3S)-4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-oxo-2-piperazin-1-ylethyl)-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | CC(c1ccc(Cl)cc1N)N1C(=O)c2cc(I)ccc2N(CC(=O)N2CCNCC2)C(=O)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28Cl2IN5O3/c1-17(22-8-6-20(31)14-24(22)33)37-27(18-2-4-19(30)5-3-18)29(40)36(16-26(38)35-12-10-34-11-13-35)25-9-7-21(32)15-23(25)28(37)39/h2-9,14-15,17,27,34H,10-13,16,33H2,1H3/t17?,27-/m0/s1 |
| InChIKey | NUGGDLILWIMASB-LYTHVRBOSA-N |
| XLogP | 4.90 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|