C30H33Cl2N3O3 — CID 67556527
4-[1-(2-amino-4-chlorophenyl)ethyl]-1-(2-butoxyethyl)-3-(4-chlorophenyl)-7-methyl-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 67556527) has the molecular formula C30H33Cl2N3O3 and a molecular weight of 554.52 g/mol. Its IUPAC name is 4-[1-(2-amino-4-chlorophenyl)ethyl]-1-(2-butoxyethyl)-3-(4-chlorophenyl)-7-methyl-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 4-[1-(2-amino-4-chlorophenyl)ethyl]-1-(2-butoxyethyl)-3-(4-chlorophenyl)-7-methyl-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 67556527 |
| Molecular Formula | C30H33Cl2N3O3 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 4-[1-(2-amino-4-chlorophenyl)ethyl]-1-(2-butoxyethyl)-3-(4-chlorophenyl)-7-methyl-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | CCCCOCCN1C(=O)C(c2ccc(Cl)cc2)N(C(C)c2ccc(Cl)cc2N)C(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C30H33Cl2N3O3/c1-4-5-15-38-16-14-34-27-13-6-19(2)17-25(27)29(36)35(20(3)24-12-11-23(32)18-26(24)33)28(30(34)37)21-7-9-22(31)10-8-21/h6-13,17-18,20,28H,4-5,14-16,33H2,1-3H3 |
| InChIKey | JJFFKKRGPNSNTG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|