C27H27Cl2IN3NaO4 — CID 173198023
sodium;5-[4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-2,5-dioxo-3,4a-dihydroquinoxalin-1-yl]pentanoic acid;hydride (PubChem CID 173198023) has the molecular formula C27H27Cl2IN3NaO4 and a molecular weight of 678.33 g/mol. Its IUPAC name is sodium;5-[4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-2,5-dioxo-3,4a-dihydroquinoxalin-1-yl]pentanoic acid;hydride.
| Compound Name | sodium;5-[4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-2,5-dioxo-3,4a-dihydroquinoxalin-1-yl]pentanoic acid;hydride |
|---|---|
| PubChem CID | 173198023 |
| Molecular Formula | C27H27Cl2IN3NaO4 |
| Molecular Weight | 678.33 g/mol |
| Exact Mass | 677.03 |
| IUPAC Name | sodium;5-[4-[1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-2,5-dioxo-3,4a-dihydroquinoxalin-1-yl]pentanoic acid;hydride |
| SMILES | CC(c1ccc(Cl)cc1N)N1C2C(=O)C=C(I)C=C2N(CCCCC(=O)O)C(=O)C1c1ccc(Cl)cc1.[H-].[Na+] |
| InChI | InChI=1S/C27H26Cl2IN3O4.Na.H/c1-15(20-10-9-18(29)12-21(20)31)33-25(16-5-7-17(28)8-6-16)27(37)32(11-3-2-4-24(35)36)22-13-19(30)14-23(34)26(22)33;;/h5-10,12-15,25-26H,2-4,11,31H2,1H3,(H,35,36);;/q;+1;-1 |
| InChIKey | XFWPTPKACGJEOK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|