C31H34Cl2IN5O2 — CID 11953139
4-[(2-amino-4-chlorophenyl)methyl]-3-(4-chlorophenyl)-7-iodo-1-[4-(4-methylpiperazin-1-yl)butyl]-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 11953139) has the molecular formula C31H34Cl2IN5O2 and a molecular weight of 706.46 g/mol. Its IUPAC name is 4-[(2-amino-4-chlorophenyl)methyl]-3-(4-chlorophenyl)-7-iodo-1-[4-(4-methylpiperazin-1-yl)butyl]-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 4-[(2-amino-4-chlorophenyl)methyl]-3-(4-chlorophenyl)-7-iodo-1-[4-(4-methylpiperazin-1-yl)butyl]-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 11953139 |
| Molecular Formula | C31H34Cl2IN5O2 |
| Molecular Weight | 706.46 g/mol |
| Exact Mass | 705.11 |
| IUPAC Name | 4-[(2-amino-4-chlorophenyl)methyl]-3-(4-chlorophenyl)-7-iodo-1-[4-(4-methylpiperazin-1-yl)butyl]-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | CN1CCN(CCCCN2C(=O)C(c3ccc(Cl)cc3)N(Cc3ccc(Cl)cc3N)C(=O)c3cc(I)ccc32)CC1 |
| InChI | InChI=1S/C31H34Cl2IN5O2/c1-36-14-16-37(17-15-36)12-2-3-13-38-28-11-10-25(34)19-26(28)30(40)39(20-22-6-9-24(33)18-27(22)35)29(31(38)41)21-4-7-23(32)8-5-21/h4-11,18-19,29H,2-3,12-17,20,35H2,1H3 |
| InChIKey | MUHZTXDQFRVJAS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|