C30H29Cl2IN2O5 — CID 11953250
3-(4-chlorophenyl)-4-[(4-chloro-2-prop-2-enoxyphenyl)methyl]-7-iodo-1-[2-(2-methoxyethoxy)ethyl]-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 11953250) has the molecular formula C30H29Cl2IN2O5 and a molecular weight of 695.38 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[(4-chloro-2-prop-2-enoxyphenyl)methyl]-7-iodo-1-[2-(2-methoxyethoxy)ethyl]-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-[(4-chloro-2-prop-2-enoxyphenyl)methyl]-7-iodo-1-[2-(2-methoxyethoxy)ethyl]-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 11953250 |
| Molecular Formula | C30H29Cl2IN2O5 |
| Molecular Weight | 695.38 g/mol |
| Exact Mass | 694.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[(4-chloro-2-prop-2-enoxyphenyl)methyl]-7-iodo-1-[2-(2-methoxyethoxy)ethyl]-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | C=CCOc1cc(Cl)ccc1CN1C(=O)c2cc(I)ccc2N(CCOCCOC)C(=O)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29Cl2IN2O5/c1-3-13-40-27-17-23(32)9-6-21(27)19-35-28(20-4-7-22(31)8-5-20)30(37)34(12-14-39-16-15-38-2)26-11-10-24(33)18-25(26)29(35)36/h3-11,17-18,28H,1,12-16,19H2,2H3 |
| InChIKey | ROSFDQQEKJVLGC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.38 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|