C30H29Cl2IN2O4 — CID 11952857
7-[(3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]heptanoic acid (PubChem CID 11952857) has the molecular formula C30H29Cl2IN2O4 and a molecular weight of 679.38 g/mol. Its IUPAC name is 7-[(3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]heptanoic acid.
| Compound Name | 7-[(3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 11952857 |
| Molecular Formula | C30H29Cl2IN2O4 |
| Molecular Weight | 679.38 g/mol |
| Exact Mass | 678.05 |
| IUPAC Name | 7-[(3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-2,5-dioxo-3H-1,4-benzodiazepin-1-yl]heptanoic acid |
| SMILES | C[C@H](c1ccc(Cl)cc1)N1C(=O)c2cc(I)ccc2N(CCCCCCC(=O)O)C(=O)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29Cl2IN2O4/c1-19(20-7-11-22(31)12-8-20)35-28(21-9-13-23(32)14-10-21)30(39)34(17-5-3-2-4-6-27(36)37)26-16-15-24(33)18-25(26)29(35)38/h7-16,18-19,28H,2-6,17H2,1H3,(H,36,37)/t19-,28+/m1/s1 |
| InChIKey | URQORSCWYPDIAO-GDJIYFAZSA-N |
| XLogP | 7.92 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.38 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|