C27H23Cl2IN2O4 — CID 67554678
(6aS,11S)-9-chloro-11-(4-chlorophenyl)-2-iodo-5-[2-(2-methoxyethoxy)ethyl]-6a,11-dihydroisoindolo[1,2-c][1,4]benzodiazepine-6,13-dione (PubChem CID 67554678) has the molecular formula C27H23Cl2IN2O4 and a molecular weight of 637.30 g/mol. Its IUPAC name is (6aS,11S)-9-chloro-11-(4-chlorophenyl)-2-iodo-5-[2-(2-methoxyethoxy)ethyl]-6a,11-dihydroisoindolo[1,2-c][1,4]benzodiazepine-6,13-dione.
| Compound Name | (6aS,11S)-9-chloro-11-(4-chlorophenyl)-2-iodo-5-[2-(2-methoxyethoxy)ethyl]-6a,11-dihydroisoindolo[1,2-c][1,4]benzodiazepine-6,13-dione |
|---|---|
| PubChem CID | 67554678 |
| Molecular Formula | C27H23Cl2IN2O4 |
| Molecular Weight | 637.30 g/mol |
| Exact Mass | 636.01 |
| IUPAC Name | (6aS,11S)-9-chloro-11-(4-chlorophenyl)-2-iodo-5-[2-(2-methoxyethoxy)ethyl]-6a,11-dihydroisoindolo[1,2-c][1,4]benzodiazepine-6,13-dione |
| SMILES | COCCOCCN1C(=O)[C@@H]2c3ccc(Cl)cc3[C@H](c3ccc(Cl)cc3)N2C(=O)c2cc(I)ccc21 |
| InChI | InChI=1S/C27H23Cl2IN2O4/c1-35-12-13-36-11-10-31-23-9-7-19(30)15-22(23)26(33)32-24(16-2-4-17(28)5-3-16)21-14-18(29)6-8-20(21)25(32)27(31)34/h2-9,14-15,24-25H,10-13H2,1H3/t24-,25-/m0/s1 |
| InChIKey | XJQAOPBUSXSCHG-DQEYMECFSA-N |
| XLogP | 5.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.30 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|