C29H28N4O4S — CID 67560257
N-(2-aminophenyl)-4-[[3,4-dimethoxy-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzamide (PubChem CID 67560257) has the molecular formula C29H28N4O4S and a molecular weight of 528.63 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[3,4-dimethoxy-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[3,4-dimethoxy-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzamide |
|---|---|
| PubChem CID | 67560257 |
| Molecular Formula | C29H28N4O4S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[3,4-dimethoxy-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzamide |
| SMILES | COc1ccc(N(Cc2ccc(C(=O)Nc3ccccc3N)cc2)C(=O)Nc2ccc(S)cc2)cc1OC |
| InChI | InChI=1S/C29H28N4O4S/c1-36-26-16-13-22(17-27(26)37-2)33(29(35)31-21-11-14-23(38)15-12-21)18-19-7-9-20(10-8-19)28(34)32-25-6-4-3-5-24(25)30/h3-17,38H,18,30H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | SFNCOBNQYKRMRO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|