C25H32ClN5O7S — CID 67563380
methyl (2S)-3-[[2-[(4R,6S)-4-(4-methanehydrazonoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(2-methylphenyl)sulfonylamino]propanoate;hydrochloride (PubChem CID 67563380) has the molecular formula C25H32ClN5O7S and a molecular weight of 582.08 g/mol. Its IUPAC name is methyl (2S)-3-[[2-[(4R,6S)-4-(4-methanehydrazonoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(2-methylphenyl)sulfonylamino]propanoate;hydrochloride.
| Compound Name | methyl (2S)-3-[[2-[(4R,6S)-4-(4-methanehydrazonoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(2-methylphenyl)sulfonylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 67563380 |
| Molecular Formula | C25H32ClN5O7S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | methyl (2S)-3-[[2-[(4R,6S)-4-(4-methanehydrazonoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(2-methylphenyl)sulfonylamino]propanoate;hydrochloride |
| SMILES | COC(=O)[C@H](CNC(=O)C[C@@H]1C[C@H](c2ccc(C=NN)cc2)N(C)C(=O)O1)NS(=O)(=O)c1ccccc1C.Cl |
| InChI | InChI=1S/C25H31N5O7S.ClH/c1-16-6-4-5-7-22(16)38(34,35)29-20(24(32)36-3)15-27-23(31)13-19-12-21(30(2)25(33)37-19)18-10-8-17(9-11-18)14-28-26;/h4-11,14,19-21,29H,12-13,15,26H2,1-3H3,(H,27,31);1H/t19-,20-,21+;/m0./s1 |
| InChIKey | YSRUQRIZIAFLDR-OBEKMTESSA-N |
| XLogP | 1.62 |
| TPSA | 169.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|