C27H23N3O5S — CID 67580802
[3-[[(E)-2-cyano-3-[(4-methylphenyl)sulfonylamino]-3-phenylprop-2-enoyl]amino]phenyl] 2-methylprop-2-enoate (PubChem CID 67580802) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is [3-[[(E)-2-cyano-3-[(4-methylphenyl)sulfonylamino]-3-phenylprop-2-enoyl]amino]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[(E)-2-cyano-3-[(4-methylphenyl)sulfonylamino]-3-phenylprop-2-enoyl]amino]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67580802 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | [3-[[(E)-2-cyano-3-[(4-methylphenyl)sulfonylamino]-3-phenylprop-2-enoyl]amino]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cccc(NC(=O)/C(C#N)=C(/NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H23N3O5S/c1-18(2)27(32)35-22-11-7-10-21(16-22)29-26(31)24(17-28)25(20-8-5-4-6-9-20)30-36(33,34)23-14-12-19(3)13-15-23/h4-16,30H,1H2,2-3H3,(H,29,31)/b25-24+ |
| InChIKey | YZALGIIBMMPNOW-OCOZRVBESA-N |
| XLogP | 4.33 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|