C26H28F2 — CID 67589129
1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 67589129) has the molecular formula C26H28F2 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 67589129 |
| Molecular Formula | C26H28F2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | CCCC1CCC(/C(F)=C(\F)c2ccc(C#Cc3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H28F2/c1-3-4-20-11-15-23(16-12-20)25(27)26(28)24-17-13-22(14-18-24)10-9-21-7-5-19(2)6-8-21/h5-8,13-14,17-18,20,23H,3-4,11-12,15-16H2,1-2H3/b26-25+ |
| InChIKey | HCKVXXMJWSOJFW-OCEACIFDSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|